C15H22O4 — CID 14633211
(3S,3aS,4aS,8aR,9aR)-3a-hydroperoxy-3,8a-dimethyl-5-methylidene-3,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 14633211) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3S,3aS,4aS,8aR,9aR)-3a-hydroperoxy-3,8a-dimethyl-5-methylidene-3,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,4aS,8aR,9aR)-3a-hydroperoxy-3,8a-dimethyl-5-methylidene-3,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 14633211 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3S,3aS,4aS,8aR,9aR)-3a-hydroperoxy-3,8a-dimethyl-5-methylidene-3,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@@H](C)[C@@]3(OO)C[C@@H]12 |
| InChI | InChI=1S/C15H22O4/c1-9-5-4-6-14(3)8-12-15(19-17,7-11(9)14)10(2)13(16)18-12/h10-12,17H,1,4-8H2,2-3H3/t10-,11+,12-,14-,15+/m1/s1 |
| InChIKey | VLCHYVSJZMSSLR-OGMFBOKVSA-N |
| XLogP | 2.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|