C17H24O2 — CID 11108081
(2'R,3aR,4aS,8aR,9aR)-2',8a-dimethyl-5-methylidenespiro[3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3,1'-cyclopropane]-2-one (PubChem CID 11108081) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (2'R,3aR,4aS,8aR,9aR)-2',8a-dimethyl-5-methylidenespiro[3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3,1'-cyclopropane]-2-one.
| Compound Name | (2'R,3aR,4aS,8aR,9aR)-2',8a-dimethyl-5-methylidenespiro[3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 11108081 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (2'R,3aR,4aS,8aR,9aR)-2',8a-dimethyl-5-methylidenespiro[3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3,1'-cyclopropane]-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)C4(C[C@H]4C)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C17H24O2/c1-10-5-4-6-16(3)9-14-13(7-12(10)16)17(8-11(17)2)15(18)19-14/h11-14H,1,4-9H2,2-3H3/t11-,12+,13+,14-,16-,17?/m1/s1 |
| InChIKey | FBHYCHLSSUMCIU-GKYUGCDLSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|