C25H45FO2 — CID 146333640
(7Z,16Z)-2-ethoxy-22-fluoro-2-methyldocosa-7,16-dien-3-one (PubChem CID 146333640) has the molecular formula C25H45FO2 and a molecular weight of 396.63 g/mol. Its IUPAC name is (7Z,16Z)-2-ethoxy-22-fluoro-2-methyldocosa-7,16-dien-3-one.
| Compound Name | (7Z,16Z)-2-ethoxy-22-fluoro-2-methyldocosa-7,16-dien-3-one |
|---|---|
| PubChem CID | 146333640 |
| Molecular Formula | C25H45FO2 |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | (7Z,16Z)-2-ethoxy-22-fluoro-2-methyldocosa-7,16-dien-3-one |
| SMILES | CCOC(C)(C)C(=O)CCC/C=C\CCCCCCC/C=C\CCCCCF |
| InChI | InChI=1S/C25H45FO2/c1-4-28-25(2,3)24(27)22-20-18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21-23-26/h11,13-14,16H,4-10,12,15,17-23H2,1-3H3/b13-11-,16-14- |
| InChIKey | UVUIRCIJLPYFMF-IEFDFHFWSA-N |
| XLogP | 7.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|