C43H34N2O — CID 146337191
N-[4-[4-[2-(2-methoxyphenyl)-6-phenyl-4-pyridinyl]phenyl]phenyl]-4-methyl-N-phenylaniline (PubChem CID 146337191) has the molecular formula C43H34N2O and a molecular weight of 594.76 g/mol. Its IUPAC name is N-[4-[4-[2-(2-methoxyphenyl)-6-phenyl-4-pyridinyl]phenyl]phenyl]-4-methyl-N-phenylaniline.
| Compound Name | N-[4-[4-[2-(2-methoxyphenyl)-6-phenyl-4-pyridinyl]phenyl]phenyl]-4-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 146337191 |
| Molecular Formula | C43H34N2O |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | N-[4-[4-[2-(2-methoxyphenyl)-6-phenyl-4-pyridinyl]phenyl]phenyl]-4-methyl-N-phenylaniline |
| SMILES | COc1ccccc1-c1cc(-c2ccc(-c3ccc(N(c4ccccc4)c4ccc(C)cc4)cc3)cc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C43H34N2O/c1-31-17-25-38(26-18-31)45(37-13-7-4-8-14-37)39-27-23-33(24-28-39)32-19-21-34(22-20-32)36-29-41(35-11-5-3-6-12-35)44-42(30-36)40-15-9-10-16-43(40)46-2/h3-30H,1-2H3 |
| InChIKey | UONOZMKUPVDJJL-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |