C43H34N2O — CID 142449372
5-[2-(2-methoxyphenyl)-6-phenyl-4-pyridinyl]-N-(4-methylphenyl)-2-(4-phenylphenyl)aniline (PubChem CID 142449372) has the molecular formula C43H34N2O and a molecular weight of 594.76 g/mol. Its IUPAC name is 5-[2-(2-methoxyphenyl)-6-phenyl-4-pyridinyl]-N-(4-methylphenyl)-2-(4-phenylphenyl)aniline.
| Compound Name | 5-[2-(2-methoxyphenyl)-6-phenyl-4-pyridinyl]-N-(4-methylphenyl)-2-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 142449372 |
| Molecular Formula | C43H34N2O |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 5-[2-(2-methoxyphenyl)-6-phenyl-4-pyridinyl]-N-(4-methylphenyl)-2-(4-phenylphenyl)aniline |
| SMILES | COc1ccccc1-c1cc(-c2ccc(-c3ccc(-c4ccccc4)cc3)c(Nc3ccc(C)cc3)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C43H34N2O/c1-30-17-24-37(25-18-30)44-41-27-35(23-26-38(41)33-21-19-32(20-22-33)31-11-5-3-6-12-31)36-28-40(34-13-7-4-8-14-34)45-42(29-36)39-15-9-10-16-43(39)46-2/h3-29,44H,1-2H3 |
| InChIKey | YYIHEHVEGBSHFX-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |