C20H32O3 — CID 146338237
(5Z,9Z,11Z,13E)-8,15-dihydroxyicosa-5,9,11,13-tetraenal (PubChem CID 146338237) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (5Z,9Z,11Z,13E)-8,15-dihydroxyicosa-5,9,11,13-tetraenal.
| Compound Name | (5Z,9Z,11Z,13E)-8,15-dihydroxyicosa-5,9,11,13-tetraenal |
|---|---|
| PubChem CID | 146338237 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (5Z,9Z,11Z,13E)-8,15-dihydroxyicosa-5,9,11,13-tetraenal |
| SMILES | CCCCCC(O)/C=C/C=C\C=C/C(O)C/C=C\CCCC=O |
| InChI | InChI=1S/C20H32O3/c1-2-3-9-14-19(22)16-11-6-7-12-17-20(23)15-10-5-4-8-13-18-21/h5-7,10-12,16-20,22-23H,2-4,8-9,13-15H2,1H3/b7-6-,10-5-,16-11+,17-12- |
| InChIKey | NRCWIZLIJFZWES-ITEJTKDISA-N |
| XLogP | 4.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|