C22H34O5 — CID 10926959
diethyl 2-[(1Z,3E,5E,9Z)-7-hydroxypentadeca-1,3,5,9-tetraenyl]propanedioate (PubChem CID 10926959) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is diethyl 2-[(1Z,3E,5E,9Z)-7-hydroxypentadeca-1,3,5,9-tetraenyl]propanedioate.
| Compound Name | diethyl 2-[(1Z,3E,5E,9Z)-7-hydroxypentadeca-1,3,5,9-tetraenyl]propanedioate |
|---|---|
| PubChem CID | 10926959 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | diethyl 2-[(1Z,3E,5E,9Z)-7-hydroxypentadeca-1,3,5,9-tetraenyl]propanedioate |
| SMILES | CCCCC/C=C\CC(O)/C=C/C=C/C=C\C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C22H34O5/c1-4-7-8-9-10-13-16-19(23)17-14-11-12-15-18-20(21(24)26-5-2)22(25)27-6-3/h10-15,17-20,23H,4-9,16H2,1-3H3/b12-11+,13-10-,17-14+,18-15- |
| InChIKey | JCGDYEBXVDKZRI-BQZRFQIRSA-N |
| XLogP | 4.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|