C22H34O4 — CID 14775050
ethyl (5Z,9E,11E,14E)-8-hydroxy-13-oxoicosa-5,9,11,14-tetraenoate (PubChem CID 14775050) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is ethyl (5Z,9E,11E,14E)-8-hydroxy-13-oxoicosa-5,9,11,14-tetraenoate.
| Compound Name | ethyl (5Z,9E,11E,14E)-8-hydroxy-13-oxoicosa-5,9,11,14-tetraenoate |
|---|---|
| PubChem CID | 14775050 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | ethyl (5Z,9E,11E,14E)-8-hydroxy-13-oxoicosa-5,9,11,14-tetraenoate |
| SMILES | CCCCC/C=C/C(=O)/C=C/C=C/C(O)C/C=C\CCCC(=O)OCC |
| InChI | InChI=1S/C22H34O4/c1-3-5-6-7-10-15-20(23)17-13-14-18-21(24)16-11-8-9-12-19-22(25)26-4-2/h8,10-11,13-15,17-18,21,24H,3-7,9,12,16,19H2,1-2H3/b11-8-,15-10+,17-13+,18-14+ |
| InChIKey | ZABCGHGUUMDMBG-YLLCODCMSA-N |
| XLogP | 4.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|