C9H13NO2 — CID 146338302
1-[(buta-1,3-dien-2-ylamino)methyl]cyclopropane-1-carboxylic acid (PubChem CID 146338302) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-[(buta-1,3-dien-2-ylamino)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(buta-1,3-dien-2-ylamino)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 146338302 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-[(buta-1,3-dien-2-ylamino)methyl]cyclopropane-1-carboxylic acid |
| SMILES | C=CC(=C)NCC1(C(=O)O)CC1 |
| InChI | InChI=1S/C9H13NO2/c1-3-7(2)10-6-9(4-5-9)8(11)12/h3,10H,1-2,4-6H2,(H,11,12) |
| InChIKey | SXGUEPNSQWHOOC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|