C23H23ClN6O4 — CID 146346456
(2R,3R,3aS,6S,6aR)-6-(2-amino-3-chloroquinolin-7-yl)oxy-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol (PubChem CID 146346456) has the molecular formula C23H23ClN6O4 and a molecular weight of 482.93 g/mol. Its IUPAC name is (2R,3R,3aS,6S,6aR)-6-(2-amino-3-chloroquinolin-7-yl)oxy-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol.
| Compound Name | (2R,3R,3aS,6S,6aR)-6-(2-amino-3-chloroquinolin-7-yl)oxy-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol |
|---|---|
| PubChem CID | 146346456 |
| Molecular Formula | C23H23ClN6O4 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (2R,3R,3aS,6S,6aR)-6-(2-amino-3-chloroquinolin-7-yl)oxy-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol |
| SMILES | Cc1cn([C@@H]2O[C@@H]3[C@@H](Oc4ccc5cc(Cl)c(N)nc5c4)CC[C@]3(O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C23H23ClN6O4/c1-10-8-30(21-16(10)20(26)27-9-28-21)22-17(31)23(32)5-4-15(18(23)34-22)33-12-3-2-11-6-13(24)19(25)29-14(11)7-12/h2-3,6-9,15,17-18,22,31-32H,4-5H2,1H3,(H2,25,29)(H2,26,27,28)/t15-,17-,18+,22+,23-/m0/s1 |
| InChIKey | XWENZSZFSCRRNQ-HCEATEFRSA-N |
| XLogP | 2.34 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |