C24H25ClN6O3 — CID 146346283
(2R,3R,3aS,6S,6aR)-6-[(2-amino-3-chloroquinolin-7-yl)methyl]-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol (PubChem CID 146346283) has the molecular formula C24H25ClN6O3 and a molecular weight of 480.96 g/mol. Its IUPAC name is (2R,3R,3aS,6S,6aR)-6-[(2-amino-3-chloroquinolin-7-yl)methyl]-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol.
| Compound Name | (2R,3R,3aS,6S,6aR)-6-[(2-amino-3-chloroquinolin-7-yl)methyl]-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol |
|---|---|
| PubChem CID | 146346283 |
| Molecular Formula | C24H25ClN6O3 |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | (2R,3R,3aS,6S,6aR)-6-[(2-amino-3-chloroquinolin-7-yl)methyl]-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol |
| SMILES | Cc1cn([C@@H]2O[C@@H]3[C@H](Cc4ccc5cc(Cl)c(N)nc5c4)CC[C@]3(O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C24H25ClN6O3/c1-11-9-31(22-17(11)21(27)28-10-29-22)23-18(32)24(33)5-4-14(19(24)34-23)6-12-2-3-13-8-15(25)20(26)30-16(13)7-12/h2-3,7-10,14,18-19,23,32-33H,4-6H2,1H3,(H2,26,30)(H2,27,28,29)/t14-,18-,19+,23+,24-/m0/s1 |
| InChIKey | RROUNUYFOLVKJM-MBHBNJSUSA-N |
| XLogP | 2.75 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |