C23H36N4O3S — CID 146346745
2-[4-[(3S,5R,10S,12R,13S,14S,17S)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-1,3-thiazol-2-yl]guanidine (PubChem CID 146346745) has the molecular formula C23H36N4O3S and a molecular weight of 448.63 g/mol. Its IUPAC name is 2-[4-[(3S,5R,10S,12R,13S,14S,17S)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[(3S,5R,10S,12R,13S,14S,17S)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 146346745 |
| Molecular Formula | C23H36N4O3S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[4-[(3S,5R,10S,12R,13S,14S,17S)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-1,3-thiazol-2-yl]guanidine |
| SMILES | C[C@]12[C@H](O)CC3C(CC[C@@H]4C[C@@H](O)CC[C@]34C)[C@@]1(O)CC[C@@H]2c1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C23H36N4O3S/c1-21-7-5-13(28)9-12(21)3-4-14-16(21)10-18(29)22(2)15(6-8-23(14,22)30)17-11-31-20(26-17)27-19(24)25/h11-16,18,28-30H,3-10H2,1-2H3,(H4,24,25,26,27)/t12-,13+,14?,15-,16?,18-,21+,22+,23+/m1/s1 |
| InChIKey | GODXHZDEYNJNEA-UJRPUXJMSA-N |
| XLogP | 2.62 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|