C23H35NO2 — CID 157478076
(3S,5R,10S,13R,14S,17S)-10,13-dimethyl-17-(3H-pyrrol-5-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol (PubChem CID 157478076) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (3S,5R,10S,13R,14S,17S)-10,13-dimethyl-17-(3H-pyrrol-5-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (3S,5R,10S,13R,14S,17S)-10,13-dimethyl-17-(3H-pyrrol-5-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 157478076 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (3S,5R,10S,13R,14S,17S)-10,13-dimethyl-17-(3H-pyrrol-5-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
| SMILES | C[C@]12CC[C@H](O)C[C@H]1CCC1C2CC[C@]2(C)[C@@H](C3=CCC=N3)CC[C@]12O |
| InChI | InChI=1S/C23H35NO2/c1-21-10-7-16(25)14-15(21)5-6-18-17(21)8-11-22(2)19(9-12-23(18,22)26)20-4-3-13-24-20/h4,13,15-19,25-26H,3,5-12,14H2,1-2H3/t15-,16+,17?,18?,19-,21+,22-,23+/m1/s1 |
| InChIKey | GLVAJIDZFVPEJG-OVGJERKQSA-N |
| XLogP | 4.48 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |