C24H34O5 — CID 44559622
(1S,6S)-6-[(3S,5R,8R,9S,10S,13R,14S,17S)-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2,7-dioxabicyclo[4.1.0]hept-4-en-3-one (PubChem CID 44559622) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is (1S,6S)-6-[(3S,5R,8R,9S,10S,13R,14S,17S)-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2,7-dioxabicyclo[4.1.0]hept-4-en-3-one.
| Compound Name | (1S,6S)-6-[(3S,5R,8R,9S,10S,13R,14S,17S)-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2,7-dioxabicyclo[4.1.0]hept-4-en-3-one |
|---|---|
| PubChem CID | 44559622 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (1S,6S)-6-[(3S,5R,8R,9S,10S,13R,14S,17S)-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2,7-dioxabicyclo[4.1.0]hept-4-en-3-one |
| SMILES | C[C@]12CC[C@H](O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@@]34C=CC(=O)O[C@@H]3O4)CC[C@]12O |
| InChI | InChI=1S/C24H34O5/c1-21-9-5-15(25)13-14(21)3-4-17-16(21)6-10-22(2)18(7-12-24(17,22)27)23-11-8-19(26)28-20(23)29-23/h8,11,14-18,20,25,27H,3-7,9-10,12-13H2,1-2H3/t14-,15+,16+,17-,18+,20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | OCYAAZOSHMXOCZ-RCFAHZIJSA-N |
| XLogP | 3.33 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|