C25H32O6 — CID 101244896
[(1R,2S,4R,6S,7R,10S,11S,16R)-7,11-dimethyl-6-[(1S,6S)-3-oxo-2,7-dioxabicyclo[4.1.0]hept-4-en-6-yl]-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] formate (PubChem CID 101244896) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is [(1R,2S,4R,6S,7R,10S,11S,16R)-7,11-dimethyl-6-[(1S,6S)-3-oxo-2,7-dioxabicyclo[4.1.0]hept-4-en-6-yl]-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] formate.
| Compound Name | [(1R,2S,4R,6S,7R,10S,11S,16R)-7,11-dimethyl-6-[(1S,6S)-3-oxo-2,7-dioxabicyclo[4.1.0]hept-4-en-6-yl]-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] formate |
|---|---|
| PubChem CID | 101244896 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [(1R,2S,4R,6S,7R,10S,11S,16R)-7,11-dimethyl-6-[(1S,6S)-3-oxo-2,7-dioxabicyclo[4.1.0]hept-4-en-6-yl]-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] formate |
| SMILES | C[C@]12CCC(OC=O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@@]34C=CC(=O)O[C@@H]3O4)C[C@H]3O[C@]132 |
| InChI | InChI=1S/C25H32O6/c1-22-8-5-15(28-13-26)11-14(22)3-4-17-16(22)6-9-23(2)18(12-19-25(17,23)30-19)24-10-7-20(27)29-21(24)31-24/h7,10,13-19,21H,3-6,8-9,11-12H2,1-2H3/t14-,15?,16+,17-,18+,19-,21-,22+,23-,24+,25-/m1/s1 |
| InChIKey | CMYYMVGNLZUIOQ-NUTWVMCCSA-N |
| XLogP | 3.53 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|