C22H28N6O3 — CID 146346871
1-[6-[3-methyl-4-[(5-oxopyrrolidin-3-yl)methoxy]phenyl]pyrazin-2-yl]-3-[(3S)-piperidin-3-yl]urea (PubChem CID 146346871) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-[6-[3-methyl-4-[(5-oxopyrrolidin-3-yl)methoxy]phenyl]pyrazin-2-yl]-3-[(3S)-piperidin-3-yl]urea.
| Compound Name | 1-[6-[3-methyl-4-[(5-oxopyrrolidin-3-yl)methoxy]phenyl]pyrazin-2-yl]-3-[(3S)-piperidin-3-yl]urea |
|---|---|
| PubChem CID | 146346871 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-[6-[3-methyl-4-[(5-oxopyrrolidin-3-yl)methoxy]phenyl]pyrazin-2-yl]-3-[(3S)-piperidin-3-yl]urea |
| SMILES | Cc1cc(-c2cncc(NC(=O)N[C@H]3CCCNC3)n2)ccc1OCC1CNC(=O)C1 |
| InChI | InChI=1S/C22H28N6O3/c1-14-7-16(4-5-19(14)31-13-15-8-21(29)25-9-15)18-11-24-12-20(27-18)28-22(30)26-17-3-2-6-23-10-17/h4-5,7,11-12,15,17,23H,2-3,6,8-10,13H2,1H3,(H,25,29)(H2,26,27,28,30)/t15?,17-/m0/s1 |
| InChIKey | SHKIEUPXXMSUAO-LWKPJOBUSA-N |
| XLogP | 1.84 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |