C20H25ClN6O2 — CID 146346912
1-[6-(3-chloro-4-morpholin-4-ylphenyl)pyrazin-2-yl]-3-piperidin-3-ylurea (PubChem CID 146346912) has the molecular formula C20H25ClN6O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 1-[6-(3-chloro-4-morpholin-4-ylphenyl)pyrazin-2-yl]-3-piperidin-3-ylurea.
| Compound Name | 1-[6-(3-chloro-4-morpholin-4-ylphenyl)pyrazin-2-yl]-3-piperidin-3-ylurea |
|---|---|
| PubChem CID | 146346912 |
| Molecular Formula | C20H25ClN6O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[6-(3-chloro-4-morpholin-4-ylphenyl)pyrazin-2-yl]-3-piperidin-3-ylurea |
| SMILES | O=C(Nc1cncc(-c2ccc(N3CCOCC3)c(Cl)c2)n1)NC1CCCNC1 |
| InChI | InChI=1S/C20H25ClN6O2/c21-16-10-14(3-4-18(16)27-6-8-29-9-7-27)17-12-23-13-19(25-17)26-20(28)24-15-2-1-5-22-11-15/h3-4,10,12-13,15,22H,1-2,5-9,11H2,(H2,24,25,26,28) |
| InChIKey | FFTJLQMBRGBKBB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |