About (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine
(2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine (PubChem CID 146347194) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine |
| PubChem CID | 146347194 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine |
| SMILES | CCN(C)C(C)(CC)[C@H](C)OC |
| InChI | InChI=1S/C10H23NO/c1-7-10(4,9(3)12-6)11(5)8-2/h9H,7-8H2,1-6H3/t9-,10?/m0/s1 |
| InChIKey | MYEZZFVJMHPWFA-RGURZIINSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine?
The IUPAC name of (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine (CID 146347194) is (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine.
What is the SMILES notation for (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine?
The canonical SMILES for (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine is CCN(C)C(C)(CC)[C@H](C)OC.
What is the InChIKey of (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine?
The InChIKey is MYEZZFVJMHPWFA-RGURZIINSA-N. The full InChI is InChI=1S/C10H23NO/c1-7-10(4,9(3)12-6)11(5)8-2/h9H,7-8H2,1-6H3/t9-,10?/m0/s1.
What are the key properties of (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine?
(2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine has a molecular weight of 173.30 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-ethyl-2-methoxy-N,3-dimethylpentan-3-amine is sourced from PubChem (CID 146347194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).