C21H22N2O2 — CID 146347272
5-(2,5-dimethoxyphenyl)-2,3,4,4a,5,8-hexahydrobenzo[7]annulene-9,9-dicarbonitrile (PubChem CID 146347272) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 5-(2,5-dimethoxyphenyl)-2,3,4,4a,5,8-hexahydrobenzo[7]annulene-9,9-dicarbonitrile.
| Compound Name | 5-(2,5-dimethoxyphenyl)-2,3,4,4a,5,8-hexahydrobenzo[7]annulene-9,9-dicarbonitrile |
|---|---|
| PubChem CID | 146347272 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 5-(2,5-dimethoxyphenyl)-2,3,4,4a,5,8-hexahydrobenzo[7]annulene-9,9-dicarbonitrile |
| SMILES | COc1ccc(OC)c(C2C=CCC(C#N)(C#N)C3=CCCCC32)c1 |
| InChI | InChI=1S/C21H22N2O2/c1-24-15-9-10-20(25-2)18(12-15)16-7-5-11-21(13-22,14-23)19-8-4-3-6-17(16)19/h5,7-10,12,16-17H,3-4,6,11H2,1-2H3 |
| InChIKey | ONILDJMSMWZLIC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|