C16H20N2O2 — CID 5212614
3,6-dibutoxybenzene-1,2-dicarbonitrile (PubChem CID 5212614) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3,6-dibutoxybenzene-1,2-dicarbonitrile.
| Compound Name | 3,6-dibutoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 5212614 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3,6-dibutoxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCOc1ccc(OCCCC)c(C#N)c1C#N |
| InChI | InChI=1S/C16H20N2O2/c1-3-5-9-19-15-7-8-16(20-10-6-4-2)14(12-18)13(15)11-17/h7-8H,3-6,9-10H2,1-2H3 |
| InChIKey | RJFAMAFEWDBSLX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|