C32H43N3O6 — CID 146347369
methyl 1-[[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]amino]cyclobutane-1-carboxylate (PubChem CID 146347369) has the molecular formula C32H43N3O6 and a molecular weight of 565.71 g/mol. Its IUPAC name is methyl 1-[[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]amino]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]amino]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 146347369 |
| Molecular Formula | C32H43N3O6 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | methyl 1-[[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]amino]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(NC[C@H](CCCCNC(=O)OCC2c3ccccc3-c3ccccc32)NC(=O)OC(C)(C)C)CCC1 |
| InChI | InChI=1S/C32H43N3O6/c1-31(2,3)41-30(38)35-22(20-34-32(17-11-18-32)28(36)39-4)12-9-10-19-33-29(37)40-21-27-25-15-7-5-13-23(25)24-14-6-8-16-26(24)27/h5-8,13-16,22,27,34H,9-12,17-21H2,1-4H3,(H,33,37)(H,35,38)/t22-/m0/s1 |
| InChIKey | KXLBFANGZJEJGD-QFIPXVFZSA-N |
| XLogP | 5.27 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|