C28H33F4N7O5 — CID 146348317
[7-(dimethylamino)-1-[[1-[[7-fluoro-4-(3,3,3-trifluoropropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-6-methyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146348317) has the molecular formula C28H33F4N7O5 and a molecular weight of 623.61 g/mol. Its IUPAC name is [7-(dimethylamino)-1-[[1-[[7-fluoro-4-(3,3,3-trifluoropropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-6-methyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [7-(dimethylamino)-1-[[1-[[7-fluoro-4-(3,3,3-trifluoropropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-6-methyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146348317 |
| Molecular Formula | C28H33F4N7O5 |
| Molecular Weight | 623.61 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | [7-(dimethylamino)-1-[[1-[[7-fluoro-4-(3,3,3-trifluoropropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-6-methyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | Cc1ccc(NC(=O)C(CCC=CC(=O)N(C)C)OC(=O)N(C)C)c(=O)n1Cc1nc2c(F)cnc(CCC(F)(F)F)c2[nH]1 |
| InChI | InChI=1S/C28H33F4N7O5/c1-16-10-11-19(34-25(41)20(44-27(43)38(4)5)8-6-7-9-22(40)37(2)3)26(42)39(16)15-21-35-23-17(29)14-33-18(24(23)36-21)12-13-28(30,31)32/h7,9-11,14,20H,6,8,12-13,15H2,1-5H3,(H,34,41)(H,35,36) |
| InChIKey | KDZMYXKORDHTDZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|