C27H31F4N7O5 — CID 175137956
methyl N-[7-(dimethylamino)-1-[[1-[[7-fluoro-4-(3,3,3-trifluoropropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-6-methyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate (PubChem CID 175137956) has the molecular formula C27H31F4N7O5 and a molecular weight of 609.58 g/mol. Its IUPAC name is methyl N-[7-(dimethylamino)-1-[[1-[[7-fluoro-4-(3,3,3-trifluoropropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-6-methyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate.
| Compound Name | methyl N-[7-(dimethylamino)-1-[[1-[[7-fluoro-4-(3,3,3-trifluoropropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-6-methyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 175137956 |
| Molecular Formula | C27H31F4N7O5 |
| Molecular Weight | 609.58 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | methyl N-[7-(dimethylamino)-1-[[1-[[7-fluoro-4-(3,3,3-trifluoropropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-6-methyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate |
| SMILES | COC(=O)NC(CCC=CC(=O)N(C)C)C(=O)Nc1ccc(C)n(Cc2nc3c(F)cnc(CCC(F)(F)F)c3[nH]2)c1=O |
| InChI | InChI=1S/C27H31F4N7O5/c1-15-9-10-19(33-24(40)18(34-26(42)43-4)7-5-6-8-21(39)37(2)3)25(41)38(15)14-20-35-22-16(28)13-32-17(23(22)36-20)11-12-27(29,30)31/h6,8-10,13,18H,5,7,11-12,14H2,1-4H3,(H,33,40)(H,34,42)(H,35,36) |
| InChIKey | DIIIKYNCMDWFFG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 151.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|