C23H26N6O5 — CID 146349305
[1-[[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl]carbamic acid (PubChem CID 146349305) has the molecular formula C23H26N6O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is [1-[[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl]carbamic acid.
| Compound Name | [1-[[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146349305 |
| Molecular Formula | C23H26N6O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [1-[[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl]carbamic acid |
| SMILES | CN(C)C(=O)C=CCCC(NC(=O)O)C(=O)Nc1cccn(Cc2nc3ccccc3[nH]2)c1=O |
| InChI | InChI=1S/C23H26N6O5/c1-28(2)20(30)12-6-5-10-17(27-23(33)34)21(31)26-18-11-7-13-29(22(18)32)14-19-24-15-8-3-4-9-16(15)25-19/h3-4,6-9,11-13,17,27H,5,10,14H2,1-2H3,(H,24,25)(H,26,31)(H,33,34) |
| InChIKey | CQQQCGXRBACDPJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|