C22H26N6O3 — CID 156756246
6-amino-N'-[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide (PubChem CID 156756246) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 6-amino-N'-[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide.
| Compound Name | 6-amino-N'-[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide |
|---|---|
| PubChem CID | 156756246 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 6-amino-N'-[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide |
| SMILES | CN(C)C(=O)C=CCCC(N)C(=O)Nc1cccn(Cc2nc3ccccc3[nH]2)c1=O |
| InChI | InChI=1S/C22H26N6O3/c1-27(2)20(29)12-6-3-8-15(23)21(30)26-18-11-7-13-28(22(18)31)14-19-24-16-9-4-5-10-17(16)25-19/h4-7,9-13,15H,3,8,14,23H2,1-2H3,(H,24,25)(H,26,30) |
| InChIKey | NIAAGVVIOMVQAH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 126.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|