C21H23N5O3 — CID 170071714
(E)-N'-[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]-N-methylhept-2-enediamide (PubChem CID 170071714) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is (E)-N'-[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]-N-methylhept-2-enediamide.
| Compound Name | (E)-N'-[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]-N-methylhept-2-enediamide |
|---|---|
| PubChem CID | 170071714 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (E)-N'-[1-(1H-benzimidazol-2-ylmethyl)-2-oxo-3-pyridinyl]-N-methylhept-2-enediamide |
| SMILES | CNC(=O)/C=C/CCCC(=O)Nc1cccn(Cc2nc3ccccc3[nH]2)c1=O |
| InChI | InChI=1S/C21H23N5O3/c1-22-19(27)11-3-2-4-12-20(28)25-17-10-7-13-26(21(17)29)14-18-23-15-8-5-6-9-16(15)24-18/h3,5-11,13H,2,4,12,14H2,1H3,(H,22,27)(H,23,24)(H,25,28)/b11-3+ |
| InChIKey | NKZPPQKSGMFCQD-QDEBKDIKSA-N |
| XLogP | 2.18 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|