C28H31N7O3 — CID 170071382
(E)-N,N-dimethyl-N'-[2-oxo-1-[[6-(2-phenylethyl)-7H-purin-8-yl]methyl]-3-pyridinyl]hept-2-enediamide (PubChem CID 170071382) has the molecular formula C28H31N7O3 and a molecular weight of 513.60 g/mol. Its IUPAC name is (E)-N,N-dimethyl-N'-[2-oxo-1-[[6-(2-phenylethyl)-7H-purin-8-yl]methyl]-3-pyridinyl]hept-2-enediamide.
| Compound Name | (E)-N,N-dimethyl-N'-[2-oxo-1-[[6-(2-phenylethyl)-7H-purin-8-yl]methyl]-3-pyridinyl]hept-2-enediamide |
|---|---|
| PubChem CID | 170071382 |
| Molecular Formula | C28H31N7O3 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | (E)-N,N-dimethyl-N'-[2-oxo-1-[[6-(2-phenylethyl)-7H-purin-8-yl]methyl]-3-pyridinyl]hept-2-enediamide |
| SMILES | CN(C)C(=O)/C=C/CCCC(=O)Nc1cccn(Cc2nc3ncnc(CCc4ccccc4)c3[nH]2)c1=O |
| InChI | InChI=1S/C28H31N7O3/c1-34(2)25(37)14-8-4-7-13-24(36)31-22-12-9-17-35(28(22)38)18-23-32-26-21(29-19-30-27(26)33-23)16-15-20-10-5-3-6-11-20/h3,5-6,8-12,14,17,19H,4,7,13,15-16,18H2,1-2H3,(H,31,36)(H,29,30,32,33)/b14-8+ |
| InChIKey | MKCFKLORWYCTEX-RIYZIHGNSA-N |
| XLogP | 3.10 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|