C30H46N6O6 — CID 153403095
(E)-N'-[1-[[5-ethenyl-4-[(E)-4-hydroxy-5-methylhex-2-en-3-yl]-1H-imidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide;formamide;methoxymethane (PubChem CID 153403095) has the molecular formula C30H46N6O6 and a molecular weight of 586.73 g/mol. Its IUPAC name is (E)-N'-[1-[[5-ethenyl-4-[(E)-4-hydroxy-5-methylhex-2-en-3-yl]-1H-imidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide;formamide;methoxymethane.
| Compound Name | (E)-N'-[1-[[5-ethenyl-4-[(E)-4-hydroxy-5-methylhex-2-en-3-yl]-1H-imidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide;formamide;methoxymethane |
|---|---|
| PubChem CID | 153403095 |
| Molecular Formula | C30H46N6O6 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | (E)-N'-[1-[[5-ethenyl-4-[(E)-4-hydroxy-5-methylhex-2-en-3-yl]-1H-imidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide;formamide;methoxymethane |
| SMILES | C=Cc1[nH]c(Cn2cccc(NC(=O)CCC/C=C/C(=O)N(C)C)c2=O)nc1/C(=C\C)C(O)C(C)C.COC.NC=O |
| InChI | InChI=1S/C27H37N5O4.C2H6O.CH3NO/c1-7-19(26(35)18(3)4)25-20(8-2)28-22(30-25)17-32-16-12-13-21(27(32)36)29-23(33)14-10-9-11-15-24(34)31(5)6;1-3-2;2-1-3/h7-8,11-13,15-16,18,26,35H,2,9-10,14,17H2,1,3-6H3,(H,28,30)(H,29,33);1-2H3;1H,(H2,2,3)/b15-11+,19-7+;; |
| InChIKey | OSDMZQVUABRGQH-MTZXMMBPSA-N |
| XLogP | 2.80 |
| TPSA | 172.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|