C28H38N6O5 — CID 153403180
(E)-N,N-dimethyl-N'-[1-[[7-(2-methylpropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;methyl carbamate (PubChem CID 153403180) has the molecular formula C28H38N6O5 and a molecular weight of 538.65 g/mol. Its IUPAC name is (E)-N,N-dimethyl-N'-[1-[[7-(2-methylpropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;methyl carbamate.
| Compound Name | (E)-N,N-dimethyl-N'-[1-[[7-(2-methylpropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;methyl carbamate |
|---|---|
| PubChem CID | 153403180 |
| Molecular Formula | C28H38N6O5 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | (E)-N,N-dimethyl-N'-[1-[[7-(2-methylpropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;methyl carbamate |
| SMILES | CC(C)Cc1ccnc2cc(Cn3cccc(NC(=O)CCC/C=C/C(=O)N(C)C)c3=O)[nH]c12.COC(N)=O |
| InChI | InChI=1S/C26H33N5O3.C2H5NO2/c1-18(2)15-19-12-13-27-22-16-20(28-25(19)22)17-31-14-8-9-21(26(31)34)29-23(32)10-6-5-7-11-24(33)30(3)4;1-5-2(3)4/h7-9,11-14,16,18,28H,5-6,10,15,17H2,1-4H3,(H,29,32);1H3,(H2,3,4)/b11-7+; |
| InChIKey | YDWBGYSGYIIZAL-RVDQCCQOSA-N |
| XLogP | 3.44 |
| TPSA | 152.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|