C30H37B2N5O5 — CID 153403228
CID 153403228 (PubChem CID 153403228) has the molecular formula C30H37B2N5O5 and a molecular weight of 569.28 g/mol.
| Compound Name | CID 153403228 |
|---|---|
| PubChem CID | 153403228 |
| Molecular Formula | C30H37B2N5O5 |
| Molecular Weight | 569.28 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C/C=C/C(=O)N(C)C)C(OC(=O)N(C)C)C(=O)Nc1cccn(Cc2cc3cccc(CC(C)C)c3[nH]2)c1=O |
| InChI | InChI=1S/C30H37B2N5O5/c1-19(2)16-20-10-7-11-21-17-22(33-25(20)21)18-37-15-9-12-23(28(37)40)34-27(39)26(42-29(41)36(5)6)30(31,32)14-8-13-24(38)35(3)4/h7-13,15,17,19,26,33H,14,16,18H2,1-6H3,(H,34,39)/b13-8+ |
| InChIKey | BZXAVQCEXJCKTP-MDWZMJQESA-N |
| XLogP | 3.07 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|