About CID 153403228
CID 153403228 (PubChem CID 153403228) has the molecular formula C30H37B2N5O5
and a molecular weight of 569.28 g/mol.
Molecular Properties
| Compound Name | CID 153403228 |
| PubChem CID | 153403228 |
| Molecular Formula | C30H37B2N5O5 |
| Molecular Weight | 569.28 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C/C=C/C(=O)N(C)C)C(OC(=O)N(C)C)C(=O)Nc1cccn(Cc2cc3cccc(CC(C)C)c3[nH]2)c1=O |
| InChI | InChI=1S/C30H37B2N5O5/c1-19(2)16-20-10-7-11-21-17-22(33-25(20)21)18-37-15-9-12-23(28(37)40)34-27(39)26(42-29(41)36(5)6)30(31,32)14-8-13-24(38)35(3)4/h7-13,15,17,19,26,33H,14,16,18H2,1-6H3,(H,34,39)/b13-8+ |
| InChIKey | BZXAVQCEXJCKTP-MDWZMJQESA-N |
| XLogP | 3.07 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 569.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 153403228 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153403228?
The IUPAC name of CID 153403228 (CID 153403228) is not available.
What is the SMILES notation for CID 153403228?
The canonical SMILES for CID 153403228 is [B]C([B])(C/C=C/C(=O)N(C)C)C(OC(=O)N(C)C)C(=O)Nc1cccn(Cc2cc3cccc(CC(C)C)c3[nH]2)c1=O.
What is the InChIKey of CID 153403228?
The InChIKey is BZXAVQCEXJCKTP-MDWZMJQESA-N. The full InChI is InChI=1S/C30H37B2N5O5/c1-19(2)16-20-10-7-11-21-17-22(33-25(20)21)18-37-15-9-12-23(28(37)40)34-27(39)26(42-29(41)36(5)6)30(31,32)14-8-13-24(38)35(3)4/h7-13,15,17,19,26,33H,14,16,18H2,1-6H3,(H,34,39)/b13-8+.
What are the key properties of CID 153403228?
CID 153403228 has a molecular weight of 569.28 g/mol, XLogP of 3.07, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153403228 is sourced from PubChem (CID 153403228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).