C35H38B2F3N5O6 — CID 153403006
CID 153403006 (PubChem CID 153403006) has the molecular formula C35H38B2F3N5O6 and a molecular weight of 703.34 g/mol.
| Compound Name | CID 153403006 |
|---|---|
| PubChem CID | 153403006 |
| Molecular Formula | C35H38B2F3N5O6 |
| Molecular Weight | 703.34 g/mol |
| Exact Mass | 703.30 |
| IUPAC Name | — |
| SMILES | CC.[B]C([B])(C/C=C/C(=O)N(C)C)C(OC(=O)N(C)C)C(=O)Nc1cccn(Cc2cc3cc(F)cc(OCc4ccc(F)cc4F)c3[nH]2)c1=O |
| InChI | InChI=1S/C33H32B2F3N5O6.C2H6/c1-41(2)27(44)8-5-11-33(34,35)29(49-32(47)42(3)4)30(45)40-25-7-6-12-43(31(25)46)17-23-14-20-13-22(37)16-26(28(20)39-23)48-18-19-9-10-21(36)15-24(19)38;1-2/h5-10,12-16,29,39H,11,17-18H2,1-4H3,(H,40,45);1-2H3/b8-5+; |
| InChIKey | BESCKRWWFQTXEX-HAAWTFQLSA-N |
| XLogP | 4.89 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|