C33H32F5N5O5 — CID 146347799
(E,6S)-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethyl-6-(3,3,3-trifluoropropanoylamino)hept-2-enediamide (PubChem CID 146347799) has the molecular formula C33H32F5N5O5 and a molecular weight of 673.64 g/mol. Its IUPAC name is (E,6S)-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethyl-6-(3,3,3-trifluoropropanoylamino)hept-2-enediamide.
| Compound Name | (E,6S)-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethyl-6-(3,3,3-trifluoropropanoylamino)hept-2-enediamide |
|---|---|
| PubChem CID | 146347799 |
| Molecular Formula | C33H32F5N5O5 |
| Molecular Weight | 673.64 g/mol |
| Exact Mass | 673.23 |
| IUPAC Name | (E,6S)-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethyl-6-(3,3,3-trifluoropropanoylamino)hept-2-enediamide |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](NC(=O)CC(F)(F)F)C(=O)Nc1cccn(Cc2cc3cccc(OCc4ccc(F)cc4F)c3[nH]2)c1=O |
| InChI | InChI=1S/C33H32F5N5O5/c1-42(2)29(45)11-4-3-8-25(40-28(44)17-33(36,37)38)31(46)41-26-9-6-14-43(32(26)47)18-23-15-20-7-5-10-27(30(20)39-23)48-19-21-12-13-22(34)16-24(21)35/h4-7,9-16,25,39H,3,8,17-19H2,1-2H3,(H,40,44)(H,41,46)/b11-4+/t25-/m0/s1 |
| InChIKey | BPZKMOCTWZABCQ-VVCKJVIVSA-N |
| XLogP | 5.04 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|