C37H39F4N5O5 — CID 146347955
(E,6S)-6-[(4,4-difluorocyclohexanecarbonyl)amino]-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide (PubChem CID 146347955) has the molecular formula C37H39F4N5O5 and a molecular weight of 709.74 g/mol. Its IUPAC name is (E,6S)-6-[(4,4-difluorocyclohexanecarbonyl)amino]-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide.
| Compound Name | (E,6S)-6-[(4,4-difluorocyclohexanecarbonyl)amino]-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide |
|---|---|
| PubChem CID | 146347955 |
| Molecular Formula | C37H39F4N5O5 |
| Molecular Weight | 709.74 g/mol |
| Exact Mass | 709.29 |
| IUPAC Name | (E,6S)-6-[(4,4-difluorocyclohexanecarbonyl)amino]-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](NC(=O)C1CCC(F)(F)CC1)C(=O)Nc1cccn(Cc2cc3cccc(OCc4ccc(F)cc4F)c3[nH]2)c1=O |
| InChI | InChI=1S/C37H39F4N5O5/c1-45(2)32(47)11-4-3-8-29(43-34(48)23-14-16-37(40,41)17-15-23)35(49)44-30-9-6-18-46(36(30)50)21-27-19-24-7-5-10-31(33(24)42-27)51-22-25-12-13-26(38)20-28(25)39/h4-7,9-13,18-20,23,29,42H,3,8,14-17,21-22H2,1-2H3,(H,43,48)(H,44,49)/b11-4+/t29-/m0/s1 |
| InChIKey | FEAXHVMKOUJVQX-REPYHNHWSA-N |
| XLogP | 5.91 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.74 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|