C25H28F3N5O6 — CID 153403072
(E)-N'-[1-[[7-(2,2-difluoroethoxy)-5-fluoro-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;methyl carbamate (PubChem CID 153403072) has the molecular formula C25H28F3N5O6 and a molecular weight of 551.52 g/mol. Its IUPAC name is (E)-N'-[1-[[7-(2,2-difluoroethoxy)-5-fluoro-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;methyl carbamate.
| Compound Name | (E)-N'-[1-[[7-(2,2-difluoroethoxy)-5-fluoro-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;methyl carbamate |
|---|---|
| PubChem CID | 153403072 |
| Molecular Formula | C25H28F3N5O6 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | (E)-N'-[1-[[7-(2,2-difluoroethoxy)-5-fluoro-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;methyl carbamate |
| SMILES | COC(N)=O.NC(=O)/C=C/CCCC(=O)Nc1cccn(Cc2cc3cc(F)cc(OCC(F)F)c3[nH]2)c1=O |
| InChI | InChI=1S/C23H23F3N4O4.C2H5NO2/c24-15-9-14-10-16(28-22(14)18(11-15)34-13-19(25)26)12-30-8-4-5-17(23(30)33)29-21(32)7-3-1-2-6-20(27)31;1-5-2(3)4/h2,4-6,8-11,19,28H,1,3,7,12-13H2,(H2,27,31)(H,29,32);1H3,(H2,3,4)/b6-2+; |
| InChIKey | FLOSIPQVQYPMSV-LKZNWTOYSA-N |
| XLogP | 3.02 |
| TPSA | 171.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|