C28H37FN6O6 — CID 153403256
(E)-N'-[1-[[6-fluoro-4-[(2-methylpropan-2-yl)oxy]-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide;methyl carbamate (PubChem CID 153403256) has the molecular formula C28H37FN6O6 and a molecular weight of 572.64 g/mol. Its IUPAC name is (E)-N'-[1-[[6-fluoro-4-[(2-methylpropan-2-yl)oxy]-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide;methyl carbamate.
| Compound Name | (E)-N'-[1-[[6-fluoro-4-[(2-methylpropan-2-yl)oxy]-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide;methyl carbamate |
|---|---|
| PubChem CID | 153403256 |
| Molecular Formula | C28H37FN6O6 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | (E)-N'-[1-[[6-fluoro-4-[(2-methylpropan-2-yl)oxy]-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide;methyl carbamate |
| SMILES | CN(C)C(=O)/C=C/CCCC(=O)Nc1cccn(Cc2nc3c(OC(C)(C)C)cc(F)cc3[nH]2)c1=O.COC(N)=O |
| InChI | InChI=1S/C26H32FN5O4.C2H5NO2/c1-26(2,3)36-20-15-17(27)14-19-24(20)30-21(28-19)16-32-13-9-10-18(25(32)35)29-22(33)11-7-6-8-12-23(34)31(4)5;1-5-2(3)4/h8-10,12-15H,6-7,11,16H2,1-5H3,(H,28,30)(H,29,33);1H3,(H2,3,4)/b12-8+; |
| InChIKey | MRCKPFGCMRZJBM-MXZHIVQLSA-N |
| XLogP | 3.55 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|