C25H27F2N5O5 — CID 170074504
ethyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-5,6-difluorobenzimidazole-1-carboxylate (PubChem CID 170074504) has the molecular formula C25H27F2N5O5 and a molecular weight of 515.52 g/mol. Its IUPAC name is ethyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-5,6-difluorobenzimidazole-1-carboxylate.
| Compound Name | ethyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-5,6-difluorobenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 170074504 |
| Molecular Formula | C25H27F2N5O5 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | ethyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-5,6-difluorobenzimidazole-1-carboxylate |
| SMILES | CCOC(=O)n1c(Cn2cccc(NC(=O)CCC/C=C/C(=O)N(C)C)c2=O)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C25H27F2N5O5/c1-4-37-25(36)32-20-14-17(27)16(26)13-19(20)28-21(32)15-31-12-8-9-18(24(31)35)29-22(33)10-6-5-7-11-23(34)30(2)3/h7-9,11-14H,4-6,10,15H2,1-3H3,(H,29,33)/b11-7+ |
| InChIKey | FQJFSBMPDJEFSX-YRNVUSSQSA-N |
| XLogP | 3.28 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|