C32H43N5O5 — CID 170072152
tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-4-(2,2-dimethylpropyl)benzimidazole-1-carboxylate (PubChem CID 170072152) has the molecular formula C32H43N5O5 and a molecular weight of 577.73 g/mol. Its IUPAC name is tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-4-(2,2-dimethylpropyl)benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-4-(2,2-dimethylpropyl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 170072152 |
| Molecular Formula | C32H43N5O5 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-4-(2,2-dimethylpropyl)benzimidazole-1-carboxylate |
| SMILES | CN(C)C(=O)/C=C/CCCC(=O)Nc1cccn(Cc2nc3c(CC(C)(C)C)cccc3n2C(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C32H43N5O5/c1-31(2,3)20-22-14-12-16-24-28(22)34-25(37(24)30(41)42-32(4,5)6)21-36-19-13-15-23(29(36)40)33-26(38)17-10-9-11-18-27(39)35(7)8/h11-16,18-19H,9-10,17,20-21H2,1-8H3,(H,33,38)/b18-11+ |
| InChIKey | RJJYAQQIKXTHNQ-WOJGMQOQSA-N |
| XLogP | 5.37 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|