C27H35FN4O2 — CID 170072239
(E)-6-[1-[[4-(2,2-dimethylpropyl)-6-fluoro-1-methylbenzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhex-2-enamide (PubChem CID 170072239) has the molecular formula C27H35FN4O2 and a molecular weight of 466.60 g/mol. Its IUPAC name is (E)-6-[1-[[4-(2,2-dimethylpropyl)-6-fluoro-1-methylbenzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhex-2-enamide.
| Compound Name | (E)-6-[1-[[4-(2,2-dimethylpropyl)-6-fluoro-1-methylbenzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 170072239 |
| Molecular Formula | C27H35FN4O2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (E)-6-[1-[[4-(2,2-dimethylpropyl)-6-fluoro-1-methylbenzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhex-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CCCc1cccn(Cc2nc3c(CC(C)(C)C)cc(F)cc3n2C)c1=O |
| InChI | InChI=1S/C27H35FN4O2/c1-27(2,3)17-20-15-21(28)16-22-25(20)29-23(31(22)6)18-32-14-10-12-19(26(32)34)11-8-7-9-13-24(33)30(4)5/h9-10,12-16H,7-8,11,17-18H2,1-6H3/b13-9+ |
| InChIKey | UGRYQFRLXRFRKH-UKTHLTGXSA-N |
| XLogP | 4.48 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|