C30H37F2N5O6 — CID 170077273
tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-5,7-difluoro-4-propan-2-yloxybenzimidazole-1-carboxylate (PubChem CID 170077273) has the molecular formula C30H37F2N5O6 and a molecular weight of 601.65 g/mol. Its IUPAC name is tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-5,7-difluoro-4-propan-2-yloxybenzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-5,7-difluoro-4-propan-2-yloxybenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 170077273 |
| Molecular Formula | C30H37F2N5O6 |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-5,7-difluoro-4-propan-2-yloxybenzimidazole-1-carboxylate |
| SMILES | CC(C)Oc1c(F)cc(F)c2c1nc(Cn1cccc(NC(=O)CCC/C=C/C(=O)N(C)C)c1=O)n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H37F2N5O6/c1-18(2)42-27-20(32)16-19(31)26-25(27)34-22(37(26)29(41)43-30(3,4)5)17-36-15-11-12-21(28(36)40)33-23(38)13-9-8-10-14-24(39)35(6)7/h10-12,14-16,18H,8-9,13,17H2,1-7H3,(H,33,38)/b14-10+ |
| InChIKey | GCRCLKGFOFRBBI-GXDHUFHOSA-N |
| XLogP | 4.85 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|