C26H33N5O4 — CID 153403171
(E)-N'-[1-[[4-(1-hydroxy-2-methylpropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide (PubChem CID 153403171) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is (E)-N'-[1-[[4-(1-hydroxy-2-methylpropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide.
| Compound Name | (E)-N'-[1-[[4-(1-hydroxy-2-methylpropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide |
|---|---|
| PubChem CID | 153403171 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (E)-N'-[1-[[4-(1-hydroxy-2-methylpropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide |
| SMILES | CC(C)C(O)c1cccc2[nH]c(Cn3cccc(NC(=O)CCC/C=C/C(=O)N(C)C)c3=O)nc12 |
| InChI | InChI=1S/C26H33N5O4/c1-17(2)25(34)18-10-8-11-19-24(18)29-21(27-19)16-31-15-9-12-20(26(31)35)28-22(32)13-6-5-7-14-23(33)30(3)4/h7-12,14-15,17,25,34H,5-6,13,16H2,1-4H3,(H,27,29)(H,28,32)/b14-7+ |
| InChIKey | NYJHNVNQIOJBTL-VGOFMYFVSA-N |
| XLogP | 3.22 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|