C26H34N6O3 — CID 170071375
(E)-N,N-dimethyl-N'-[1-[[6-methyl-4-(2-methylpropyl)-1H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide (PubChem CID 170071375) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is (E)-N,N-dimethyl-N'-[1-[[6-methyl-4-(2-methylpropyl)-1H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide.
| Compound Name | (E)-N,N-dimethyl-N'-[1-[[6-methyl-4-(2-methylpropyl)-1H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide |
|---|---|
| PubChem CID | 170071375 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (E)-N,N-dimethyl-N'-[1-[[6-methyl-4-(2-methylpropyl)-1H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide |
| SMILES | Cc1cc2[nH]c(Cn3cccc(NC(=O)CCC/C=C/C(=O)N(C)C)c3=O)nc2c(CC(C)C)n1 |
| InChI | InChI=1S/C26H34N6O3/c1-17(2)14-20-25-21(15-18(3)27-20)28-22(30-25)16-32-13-9-10-19(26(32)35)29-23(33)11-7-6-8-12-24(34)31(4)5/h8-10,12-13,15,17H,6-7,11,14,16H2,1-5H3,(H,28,30)(H,29,33)/b12-8+ |
| InChIKey | SALZHRUJJASZRA-XYOKQWHBSA-N |
| XLogP | 3.43 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|