C25H35N5O5 — CID 153403101
tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-4,5-dimethylimidazole-1-carboxylate (PubChem CID 153403101) has the molecular formula C25H35N5O5 and a molecular weight of 485.59 g/mol. Its IUPAC name is tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-4,5-dimethylimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-4,5-dimethylimidazole-1-carboxylate |
|---|---|
| PubChem CID | 153403101 |
| Molecular Formula | C25H35N5O5 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-4,5-dimethylimidazole-1-carboxylate |
| SMILES | Cc1nc(Cn2cccc(NC(=O)CCC/C=C/C(=O)N(C)C)c2=O)n(C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C25H35N5O5/c1-17-18(2)30(24(34)35-25(3,4)5)20(26-17)16-29-15-11-12-19(23(29)33)27-21(31)13-9-8-10-14-22(32)28(6)7/h10-12,14-15H,8-9,13,16H2,1-7H3,(H,27,31)/b14-10+ |
| InChIKey | ALKFQIDQTKZWLT-GXDHUFHOSA-N |
| XLogP | 3.25 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|