C27H29IN7O3P — CID 170077580
(E)-N'-[1-[(6-benzyl-9-iodophosphanylpurin-8-yl)methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide (PubChem CID 170077580) has the molecular formula C27H29IN7O3P and a molecular weight of 657.45 g/mol. Its IUPAC name is (E)-N'-[1-[(6-benzyl-9-iodophosphanylpurin-8-yl)methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide.
| Compound Name | (E)-N'-[1-[(6-benzyl-9-iodophosphanylpurin-8-yl)methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide |
|---|---|
| PubChem CID | 170077580 |
| Molecular Formula | C27H29IN7O3P |
| Molecular Weight | 657.45 g/mol |
| Exact Mass | 657.11 |
| IUPAC Name | (E)-N'-[1-[(6-benzyl-9-iodophosphanylpurin-8-yl)methyl]-2-oxo-3-pyridinyl]-N,N-dimethylhept-2-enediamide |
| SMILES | CN(C)C(=O)/C=C/CCCC(=O)Nc1cccn(Cc2nc3c(Cc4ccccc4)ncnc3n2PI)c1=O |
| InChI | InChI=1S/C27H29IN7O3P/c1-33(2)24(37)14-8-4-7-13-23(36)31-20-12-9-15-34(27(20)38)17-22-32-25-21(16-19-10-5-3-6-11-19)29-18-30-26(25)35(22)39-28/h3,5-6,8-12,14-15,18,39H,4,7,13,16-17H2,1-2H3,(H,31,36)/b14-8+ |
| InChIKey | JLTKHJLFLOHFCV-RIYZIHGNSA-N |
| XLogP | 4.17 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|