C28H34N4O5 — CID 153402955
tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]indole-1-carboxylate (PubChem CID 153402955) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 153402955 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | tert-butyl 2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]indole-1-carboxylate |
| SMILES | CN(C)C(=O)/C=C/CCCC(=O)Nc1cccn(Cc2cc3ccccc3n2C(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C28H34N4O5/c1-28(2,3)37-27(36)32-21(18-20-12-9-10-14-23(20)32)19-31-17-11-13-22(26(31)35)29-24(33)15-7-6-8-16-25(34)30(4)5/h8-14,16-18H,6-7,15,19H2,1-5H3,(H,29,33)/b16-8+ |
| InChIKey | MJISWBRCRUXUSK-LZYBPNLTSA-N |
| XLogP | 4.39 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|