C21H31N5O5 — CID 146363531
tert-butyl N-[2-[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]ethanimidoyl]carbamate (PubChem CID 146363531) has the molecular formula C21H31N5O5 and a molecular weight of 433.51 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]ethanimidoyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]ethanimidoyl]carbamate |
|---|---|
| PubChem CID | 146363531 |
| Molecular Formula | C21H31N5O5 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | tert-butyl N-[2-[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]ethanimidoyl]carbamate |
| SMILES | [H]/N=C(/Cn1cccc(NC(=O)CCC/C=C/C(=O)N(C)C)c1=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N5O5/c1-21(2,3)31-20(30)24-16(22)14-26-13-9-10-15(19(26)29)23-17(27)11-7-6-8-12-18(28)25(4)5/h8-10,12-13H,6-7,11,14H2,1-5H3,(H,23,27)(H2,22,24,30)/b12-8+ |
| InChIKey | QEEGNFYAJFGMNB-XYOKQWHBSA-N |
| XLogP | 2.10 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|