C33H35F2N5O6 — CID 170073131
tert-butyl 4-(2,4-difluorophenoxy)-2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]benzimidazole-1-carboxylate (PubChem CID 170073131) has the molecular formula C33H35F2N5O6 and a molecular weight of 635.67 g/mol. Its IUPAC name is tert-butyl 4-(2,4-difluorophenoxy)-2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 4-(2,4-difluorophenoxy)-2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 170073131 |
| Molecular Formula | C33H35F2N5O6 |
| Molecular Weight | 635.67 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | tert-butyl 4-(2,4-difluorophenoxy)-2-[[3-[[(E)-7-(dimethylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]benzimidazole-1-carboxylate |
| SMILES | CN(C)C(=O)/C=C/CCCC(=O)Nc1cccn(Cc2nc3c(Oc4ccc(F)cc4F)cccc3n2C(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C33H35F2N5O6/c1-33(2,3)46-32(44)40-24-12-9-13-26(45-25-17-16-21(34)19-22(25)35)30(24)37-27(40)20-39-18-10-11-23(31(39)43)36-28(41)14-7-6-8-15-29(42)38(4)5/h8-13,15-19H,6-7,14,20H2,1-5H3,(H,36,41)/b15-8+ |
| InChIKey | SBUBXPZTUMNRAE-OVCLIPMQSA-N |
| XLogP | 5.85 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|