C30H34F4N4O5 — CID 170075669
tert-butyl 5-fluoro-2-[[3-[[(E)-7-(methylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-7-(3,3,3-trifluoropropyl)indole-1-carboxylate (PubChem CID 170075669) has the molecular formula C30H34F4N4O5 and a molecular weight of 606.62 g/mol. Its IUPAC name is tert-butyl 5-fluoro-2-[[3-[[(E)-7-(methylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-7-(3,3,3-trifluoropropyl)indole-1-carboxylate.
| Compound Name | tert-butyl 5-fluoro-2-[[3-[[(E)-7-(methylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-7-(3,3,3-trifluoropropyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 170075669 |
| Molecular Formula | C30H34F4N4O5 |
| Molecular Weight | 606.62 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | tert-butyl 5-fluoro-2-[[3-[[(E)-7-(methylamino)-7-oxohept-5-enoyl]amino]-2-oxo-1-pyridinyl]methyl]-7-(3,3,3-trifluoropropyl)indole-1-carboxylate |
| SMILES | CNC(=O)/C=C/CCCC(=O)Nc1cccn(Cc2cc3cc(F)cc(CCC(F)(F)F)c3n2C(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C30H34F4N4O5/c1-29(2,3)43-28(42)38-22(17-20-16-21(31)15-19(26(20)38)12-13-30(32,33)34)18-37-14-8-9-23(27(37)41)36-25(40)11-7-5-6-10-24(39)35-4/h6,8-10,14-17H,5,7,11-13,18H2,1-4H3,(H,35,39)(H,36,40)/b10-6+ |
| InChIKey | HWVLUYOONGFIHC-UXBLZVDNSA-N |
| XLogP | 5.68 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|