C35H32F3N5O5 — CID 153403375
(E)-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;2-fluorobenzamide (PubChem CID 153403375) has the molecular formula C35H32F3N5O5 and a molecular weight of 659.67 g/mol. Its IUPAC name is (E)-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;2-fluorobenzamide.
| Compound Name | (E)-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;2-fluorobenzamide |
|---|---|
| PubChem CID | 153403375 |
| Molecular Formula | C35H32F3N5O5 |
| Molecular Weight | 659.67 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | (E)-N'-[1-[[7-[(2,4-difluorophenyl)methoxy]-1H-indol-2-yl]methyl]-2-oxo-3-pyridinyl]hept-2-enediamide;2-fluorobenzamide |
| SMILES | NC(=O)/C=C/CCCC(=O)Nc1cccn(Cc2cc3cccc(OCc4ccc(F)cc4F)c3[nH]2)c1=O.NC(=O)c1ccccc1F |
| InChI | InChI=1S/C28H26F2N4O4.C7H6FNO/c29-20-12-11-19(22(30)15-20)17-38-24-8-4-6-18-14-21(32-27(18)24)16-34-13-5-7-23(28(34)37)33-26(36)10-3-1-2-9-25(31)35;8-6-4-2-1-3-5(6)7(9)10/h2,4-9,11-15,32H,1,3,10,16-17H2,(H2,31,35)(H,33,36);1-4H,(H2,9,10)/b9-2+; |
| InChIKey | ONRHEGWBVXHZAU-ZUKRFDGTSA-N |
| XLogP | 5.31 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|