C30H26FN5O2 — CID 1463512
(2R)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-benzyl-2-(2-fluorophenyl)acetamide (PubChem CID 1463512) has the molecular formula C30H26FN5O2 and a molecular weight of 507.57 g/mol. Its IUPAC name is (2R)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-benzyl-2-(2-fluorophenyl)acetamide.
| Compound Name | (2R)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-benzyl-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 1463512 |
| Molecular Formula | C30H26FN5O2 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | (2R)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-benzyl-2-(2-fluorophenyl)acetamide |
| SMILES | O=C(NCc1ccccc1)[C@@H](c1ccccc1F)N(Cc1ccccc1)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C30H26FN5O2/c31-25-16-8-7-15-24(25)29(30(38)32-19-22-11-3-1-4-12-22)35(20-23-13-5-2-6-14-23)28(37)21-36-27-18-10-9-17-26(27)33-34-36/h1-18,29H,19-21H2,(H,32,38)/t29-/m1/s1 |
| InChIKey | AFIPCYREVZETIV-GDLZYMKVSA-N |
| XLogP | 4.66 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |