C32H31N5O3 — CID 98102402
(2S)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-benzyl-2-(2-ethoxyphenyl)acetamide (PubChem CID 98102402) has the molecular formula C32H31N5O3 and a molecular weight of 533.63 g/mol. Its IUPAC name is (2S)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-benzyl-2-(2-ethoxyphenyl)acetamide.
| Compound Name | (2S)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-benzyl-2-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98102402 |
| Molecular Formula | C32H31N5O3 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (2S)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-benzyl-2-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1[C@@H](C(=O)NCc1ccccc1)N(Cc1ccccc1)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C32H31N5O3/c1-2-40-29-20-12-9-17-26(29)31(32(39)33-21-24-13-5-3-6-14-24)36(22-25-15-7-4-8-16-25)30(38)23-37-28-19-11-10-18-27(28)34-35-37/h3-20,31H,2,21-23H2,1H3,(H,33,39)/t31-/m0/s1 |
| InChIKey | GPRCYVJLECIZMA-HKBQPEDESA-N |
| XLogP | 4.92 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |